C16H23N3OS — CID 60655171
2-amino-N,N-bis(2-methylpropyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 60655171) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is 2-amino-N,N-bis(2-methylpropyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-amino-N,N-bis(2-methylpropyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 60655171 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-amino-N,N-bis(2-methylpropyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C16H23N3OS/c1-10(2)8-19(9-11(3)4)15(20)12-5-6-13-14(7-12)21-16(17)18-13/h5-7,10-11H,8-9H2,1-4H3,(H2,17,18) |
| InChIKey | AMYURXQBYILXKV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |