C16H23N3OS — CID 65349489
2-amino-N-pentyl-N-propan-2-yl-1,3-benzothiazole-6-carboxamide (PubChem CID 65349489) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is 2-amino-N-pentyl-N-propan-2-yl-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-amino-N-pentyl-N-propan-2-yl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 65349489 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-amino-N-pentyl-N-propan-2-yl-1,3-benzothiazole-6-carboxamide |
| SMILES | CCCCCN(C(=O)c1ccc2nc(N)sc2c1)C(C)C |
| InChI | InChI=1S/C16H23N3OS/c1-4-5-6-9-19(11(2)3)15(20)12-7-8-13-14(10-12)21-16(17)18-13/h7-8,10-11H,4-6,9H2,1-3H3,(H2,17,18) |
| InChIKey | YLMLXCXHKJWSQU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|