C11H12N2O3S — CID 3147262
2-methoxyethyl 2-amino-1,3-benzothiazole-6-carboxylate (PubChem CID 3147262) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-methoxyethyl 2-amino-1,3-benzothiazole-6-carboxylate.
| Compound Name | 2-methoxyethyl 2-amino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3147262 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-methoxyethyl 2-amino-1,3-benzothiazole-6-carboxylate |
| SMILES | COCCOC(=O)c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C11H12N2O3S/c1-15-4-5-16-10(14)7-2-3-8-9(6-7)17-11(12)13-8/h2-3,6H,4-5H2,1H3,(H2,12,13) |
| InChIKey | SRZNIAFAHGDVEJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|