C15H11FN2O2S — CID 65348499
(2-fluorophenyl)methyl 2-amino-1,3-benzothiazole-6-carboxylate (PubChem CID 65348499) has the molecular formula C15H11FN2O2S and a molecular weight of 302.33 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 2-amino-1,3-benzothiazole-6-carboxylate.
| Compound Name | (2-fluorophenyl)methyl 2-amino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 65348499 |
| Molecular Formula | C15H11FN2O2S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | (2-fluorophenyl)methyl 2-amino-1,3-benzothiazole-6-carboxylate |
| SMILES | Nc1nc2ccc(C(=O)OCc3ccccc3F)cc2s1 |
| InChI | InChI=1S/C15H11FN2O2S/c16-11-4-2-1-3-10(11)8-20-14(19)9-5-6-12-13(7-9)21-15(17)18-12/h1-7H,8H2,(H2,17,18) |
| InChIKey | DJJQGYNINIPSCM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |