C13H16N2O3S — CID 65348498
2-propoxyethyl 2-amino-1,3-benzothiazole-6-carboxylate (PubChem CID 65348498) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-propoxyethyl 2-amino-1,3-benzothiazole-6-carboxylate.
| Compound Name | 2-propoxyethyl 2-amino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 65348498 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-propoxyethyl 2-amino-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCOCCOC(=O)c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C13H16N2O3S/c1-2-5-17-6-7-18-12(16)9-3-4-10-11(8-9)19-13(14)15-10/h3-4,8H,2,5-7H2,1H3,(H2,14,15) |
| InChIKey | DBZLYOJCJMAWFG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|