C15H20N2O3S — CID 82549183
2-ethoxyethyl 2-(propylamino)-1,3-benzothiazole-6-carboxylate (PubChem CID 82549183) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-ethoxyethyl 2-(propylamino)-1,3-benzothiazole-6-carboxylate.
| Compound Name | 2-ethoxyethyl 2-(propylamino)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 82549183 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-ethoxyethyl 2-(propylamino)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCNc1nc2ccc(C(=O)OCCOCC)cc2s1 |
| InChI | InChI=1S/C15H20N2O3S/c1-3-7-16-15-17-12-6-5-11(10-13(12)21-15)14(18)20-9-8-19-4-2/h5-6,10H,3-4,7-9H2,1-2H3,(H,16,17) |
| InChIKey | BZTNAHRWZPLVTP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|