C16H20N2O2S — CID 82549744
propyl 2-(cyclopentylamino)-1,3-benzothiazole-6-carboxylate (PubChem CID 82549744) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is propyl 2-(cyclopentylamino)-1,3-benzothiazole-6-carboxylate.
| Compound Name | propyl 2-(cyclopentylamino)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 82549744 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | propyl 2-(cyclopentylamino)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCOC(=O)c1ccc2nc(NC3CCCC3)sc2c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-2-9-20-15(19)11-7-8-13-14(10-11)21-16(18-13)17-12-5-3-4-6-12/h7-8,10,12H,2-6,9H2,1H3,(H,17,18) |
| InChIKey | ISVFUNRRHOFIBQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |