C16H19N3O2S2 — CID 126194394
methyl 2-(cyclohexylcarbamothioylamino)-1,3-benzothiazole-6-carboxylate (PubChem CID 126194394) has the molecular formula C16H19N3O2S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is methyl 2-(cyclohexylcarbamothioylamino)-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(cyclohexylcarbamothioylamino)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 126194394 |
| Molecular Formula | C16H19N3O2S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | methyl 2-(cyclohexylcarbamothioylamino)-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(NC(=S)NC3CCCCC3)sc2c1 |
| InChI | InChI=1S/C16H19N3O2S2/c1-21-14(20)10-7-8-12-13(9-10)23-16(18-12)19-15(22)17-11-5-3-2-4-6-11/h7-9,11H,2-6H2,1H3,(H2,17,18,19,22) |
| InChIKey | BLDYOVSAJZKXAP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|