C16H21N3OS2 — CID 3458373
1-cyclohexyl-3-(6-ethoxy-1,3-benzothiazol-2-yl)thiourea (PubChem CID 3458373) has the molecular formula C16H21N3OS2 and a molecular weight of 335.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-(6-ethoxy-1,3-benzothiazol-2-yl)thiourea.
| Compound Name | 1-cyclohexyl-3-(6-ethoxy-1,3-benzothiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 3458373 |
| Molecular Formula | C16H21N3OS2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-cyclohexyl-3-(6-ethoxy-1,3-benzothiazol-2-yl)thiourea |
| SMILES | CCOc1ccc2nc(NC(=S)NC3CCCCC3)sc2c1 |
| InChI | InChI=1S/C16H21N3OS2/c1-2-20-12-8-9-13-14(10-12)22-16(18-13)19-15(21)17-11-6-4-3-5-7-11/h8-11H,2-7H2,1H3,(H2,17,18,19,21) |
| InChIKey | GVUYIDQLYITTSY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|