C14H15N3O3S3 — CID 164663188
1-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-3-(6-ethoxy-1,3-benzothiazol-2-yl)thiourea (PubChem CID 164663188) has the molecular formula C14H15N3O3S3 and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-3-(6-ethoxy-1,3-benzothiazol-2-yl)thiourea.
| Compound Name | 1-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-3-(6-ethoxy-1,3-benzothiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 164663188 |
| Molecular Formula | C14H15N3O3S3 |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 1-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-3-(6-ethoxy-1,3-benzothiazol-2-yl)thiourea |
| SMILES | CCOc1ccc2nc(NC(=S)NC3=CCS(=O)(=O)C3)sc2c1 |
| InChI | InChI=1S/C14H15N3O3S3/c1-2-20-10-3-4-11-12(7-10)22-14(16-11)17-13(21)15-9-5-6-23(18,19)8-9/h3-5,7H,2,6,8H2,1H3,(H2,15,16,17,21) |
| InChIKey | GBDRATKHHQIAGH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|