C14H16N2O4S — CID 108747758
methyl 4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-4-oxobutanoate (PubChem CID 108747758) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is methyl 4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-4-oxobutanoate.
| Compound Name | methyl 4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 108747758 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | methyl 4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-4-oxobutanoate |
| SMILES | CCOc1ccc2nc(NC(=O)CCC(=O)OC)sc2c1 |
| InChI | InChI=1S/C14H16N2O4S/c1-3-20-9-4-5-10-11(8-9)21-14(15-10)16-12(17)6-7-13(18)19-2/h4-5,8H,3,6-7H2,1-2H3,(H,15,16,17) |
| InChIKey | QRDJAJSGHKRKCU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |