C19H20N2O3S — CID 46665605
N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(3-methoxyphenyl)propanamide (PubChem CID 46665605) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(3-methoxyphenyl)propanamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(3-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 46665605 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(3-methoxyphenyl)propanamide |
| SMILES | CCOc1ccc2nc(NC(=O)CCc3cccc(OC)c3)sc2c1 |
| InChI | InChI=1S/C19H20N2O3S/c1-3-24-15-8-9-16-17(12-15)25-19(20-16)21-18(22)10-7-13-5-4-6-14(11-13)23-2/h4-6,8-9,11-12H,3,7,10H2,1-2H3,(H,20,21,22) |
| InChIKey | LLEPIVDWJXOPBL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |