C20H22N2O4S — CID 26707945
3-(3,5-dimethoxyphenyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)propanamide (PubChem CID 26707945) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 3-(3,5-dimethoxyphenyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 26707945 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)propanamide |
| SMILES | CCOc1ccc2nc(NC(=O)CCc3cc(OC)cc(OC)c3)sc2c1 |
| InChI | InChI=1S/C20H22N2O4S/c1-4-26-14-6-7-17-18(12-14)27-20(21-17)22-19(23)8-5-13-9-15(24-2)11-16(10-13)25-3/h6-7,9-12H,4-5,8H2,1-3H3,(H,21,22,23) |
| InChIKey | NRVJJFSLZOECEG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |