C14H19N3O2S — CID 3926238
3-(6-ethoxy-1,3-benzothiazol-2-yl)-1,1-diethylurea (PubChem CID 3926238) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-(6-ethoxy-1,3-benzothiazol-2-yl)-1,1-diethylurea.
| Compound Name | 3-(6-ethoxy-1,3-benzothiazol-2-yl)-1,1-diethylurea |
|---|---|
| PubChem CID | 3926238 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-(6-ethoxy-1,3-benzothiazol-2-yl)-1,1-diethylurea |
| SMILES | CCOc1ccc2nc(NC(=O)N(CC)CC)sc2c1 |
| InChI | InChI=1S/C14H19N3O2S/c1-4-17(5-2)14(18)16-13-15-11-8-7-10(19-6-3)9-12(11)20-13/h7-9H,4-6H2,1-3H3,(H,15,16,18) |
| InChIKey | OAAZJMOQTHQHQT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |