C24H18N2O4S — CID 19209994
N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-(2-oxo-2-phenylacetyl)benzamide (PubChem CID 19209994) has the molecular formula C24H18N2O4S and a molecular weight of 430.49 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-(2-oxo-2-phenylacetyl)benzamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-(2-oxo-2-phenylacetyl)benzamide |
|---|---|
| PubChem CID | 19209994 |
| Molecular Formula | C24H18N2O4S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-(2-oxo-2-phenylacetyl)benzamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3ccc(C(=O)C(=O)c4ccccc4)cc3)sc2c1 |
| InChI | InChI=1S/C24H18N2O4S/c1-2-30-18-12-13-19-20(14-18)31-24(25-19)26-23(29)17-10-8-16(9-11-17)22(28)21(27)15-6-4-3-5-7-15/h3-14H,2H2,1H3,(H,25,26,29) |
| InChIKey | UPXHDIIOTIATJY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|