C23H20IN2O3S+ — CID 87394674
[4-[[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]carbamoyl]phenyl]-phenyliodanium (PubChem CID 87394674) has the molecular formula C23H20IN2O3S+ and a molecular weight of 531.40 g/mol. Its IUPAC name is [4-[[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]carbamoyl]phenyl]-phenyliodanium.
| Compound Name | [4-[[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]carbamoyl]phenyl]-phenyliodanium |
|---|---|
| PubChem CID | 87394674 |
| Molecular Formula | C23H20IN2O3S+ |
| Molecular Weight | 531.40 g/mol |
| Exact Mass | 531.02 |
| IUPAC Name | [4-[[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]carbamoyl]phenyl]-phenyliodanium |
| SMILES | CCOCOc1ccc2nc(NC(=O)c3ccc([I+]c4ccccc4)cc3)sc2c1 |
| InChI | InChI=1S/C23H19IN2O3S/c1-2-28-15-29-19-12-13-20-21(14-19)30-23(25-20)26-22(27)16-8-10-18(11-9-16)24-17-6-4-3-5-7-17/h3-14H,2,15H2,1H3/p+1 |
| InChIKey | ICMDFEMDLKWVHP-UHFFFAOYSA-O |
| XLogP | 2.05 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|