C16H13IN2O2S — CID 5186892
N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-iodobenzamide (PubChem CID 5186892) has the molecular formula C16H13IN2O2S and a molecular weight of 424.26 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-iodobenzamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-iodobenzamide |
|---|---|
| PubChem CID | 5186892 |
| Molecular Formula | C16H13IN2O2S |
| Molecular Weight | 424.26 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-iodobenzamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3ccc(I)cc3)sc2c1 |
| InChI | InChI=1S/C16H13IN2O2S/c1-2-21-12-7-8-13-14(9-12)22-16(18-13)19-15(20)10-3-5-11(17)6-4-10/h3-9H,2H2,1H3,(H,18,19,20) |
| InChIKey | BJHVVHNYQNDBOW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|