C18H18N2O4S — CID 7543004
N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-4-ethoxybenzamide (PubChem CID 7543004) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-4-ethoxybenzamide.
| Compound Name | N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-4-ethoxybenzamide |
|---|---|
| PubChem CID | 7543004 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2nc3cc(OC)c(OC)cc3s2)cc1 |
| InChI | InChI=1S/C18H18N2O4S/c1-4-24-12-7-5-11(6-8-12)17(21)20-18-19-13-9-14(22-2)15(23-3)10-16(13)25-18/h5-10H,4H2,1-3H3,(H,19,20,21) |
| InChIKey | XBMAUMGHOUEBBJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |