C18H16F2N2O4S — CID 8882972
4-(difluoromethoxy)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-methoxybenzamide (PubChem CID 8882972) has the molecular formula C18H16F2N2O4S and a molecular weight of 394.40 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-methoxybenzamide.
| Compound Name | 4-(difluoromethoxy)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 8882972 |
| Molecular Formula | C18H16F2N2O4S |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 4-(difluoromethoxy)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-methoxybenzamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3ccc(OC(F)F)c(OC)c3)sc2c1 |
| InChI | InChI=1S/C18H16F2N2O4S/c1-3-25-11-5-6-12-15(9-11)27-18(21-12)22-16(23)10-4-7-13(26-17(19)20)14(8-10)24-2/h4-9,17H,3H2,1-2H3,(H,21,22,23) |
| InChIKey | BEFUVNAHUHAVJU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |