C17H14F2N2O4S2 — CID 35996706
4-(difluoromethylsulfonyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 35996706) has the molecular formula C17H14F2N2O4S2 and a molecular weight of 412.44 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 35996706 |
| Molecular Formula | C17H14F2N2O4S2 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3ccc(S(=O)(=O)C(F)F)cc3)sc2c1 |
| InChI | InChI=1S/C17H14F2N2O4S2/c1-2-25-11-5-8-13-14(9-11)26-17(20-13)21-15(22)10-3-6-12(7-4-10)27(23,24)16(18)19/h3-9,16H,2H2,1H3,(H,20,21,22) |
| InChIKey | MRWVWOHTDAELOD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |