C18H16N2O4S — CID 4626865
[4-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl] acetate (PubChem CID 4626865) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is [4-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl] acetate.
| Compound Name | [4-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 4626865 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | [4-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl] acetate |
| SMILES | CCOc1ccc2nc(NC(=O)c3ccc(OC(C)=O)cc3)sc2c1 |
| InChI | InChI=1S/C18H16N2O4S/c1-3-23-14-8-9-15-16(10-14)25-18(19-15)20-17(22)12-4-6-13(7-5-12)24-11(2)21/h4-10H,3H2,1-2H3,(H,19,20,22) |
| InChIKey | AJAQNVSVZWCRLX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|