C16H13ClN2O3S — CID 39951417
3-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxybenzamide (PubChem CID 39951417) has the molecular formula C16H13ClN2O3S and a molecular weight of 348.81 g/mol. Its IUPAC name is 3-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxybenzamide |
|---|---|
| PubChem CID | 39951417 |
| Molecular Formula | C16H13ClN2O3S |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 3-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxybenzamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3ccc(O)c(Cl)c3)sc2c1 |
| InChI | InChI=1S/C16H13ClN2O3S/c1-2-22-10-4-5-12-14(8-10)23-16(18-12)19-15(21)9-3-6-13(20)11(17)7-9/h3-8,20H,2H2,1H3,(H,18,19,21) |
| InChIKey | UROMKHSMSNROIG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |