C18H18ClN3O5S2 — CID 27675707
4-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 27675707) has the molecular formula C18H18ClN3O5S2 and a molecular weight of 455.95 g/mol. Its IUPAC name is 4-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | 4-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 27675707 |
| Molecular Formula | C18H18ClN3O5S2 |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 4-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3ccc(Cl)c(S(=O)(=O)N(C)OC)c3)sc2c1 |
| InChI | InChI=1S/C18H18ClN3O5S2/c1-4-27-12-6-8-14-15(10-12)28-18(20-14)21-17(23)11-5-7-13(19)16(9-11)29(24,25)22(2)26-3/h5-10H,4H2,1-3H3,(H,20,21,23) |
| InChIKey | IUUGRJXMEXVNIA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|