C17H15ClN2O4S2 — CID 8883217
2-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-5-methylsulfonylbenzamide (PubChem CID 8883217) has the molecular formula C17H15ClN2O4S2 and a molecular weight of 410.90 g/mol. Its IUPAC name is 2-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-5-methylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 8883217 |
| Molecular Formula | C17H15ClN2O4S2 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 2-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-5-methylsulfonylbenzamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3cc(S(C)(=O)=O)ccc3Cl)sc2c1 |
| InChI | InChI=1S/C17H15ClN2O4S2/c1-3-24-10-4-7-14-15(8-10)25-17(19-14)20-16(21)12-9-11(26(2,22)23)5-6-13(12)18/h4-9H,3H2,1-2H3,(H,19,20,21) |
| InChIKey | SAXFBXLRLHPVNW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |