C17H16N2O4S2 — CID 2971147
3-ethoxy-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 2971147) has the molecular formula C17H16N2O4S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-ethoxy-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-ethoxy-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 2971147 |
| Molecular Formula | C17H16N2O4S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 3-ethoxy-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCOc1cccc(C(=O)Nc2nc3ccc(S(C)(=O)=O)cc3s2)c1 |
| InChI | InChI=1S/C17H16N2O4S2/c1-3-23-12-6-4-5-11(9-12)16(20)19-17-18-14-8-7-13(25(2,21)22)10-15(14)24-17/h4-10H,3H2,1-2H3,(H,18,19,20) |
| InChIKey | HLKUDUDKQQJXSY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |