C16H13ClN2O4S2 — CID 19174332
2-(3-chlorophenoxy)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide (PubChem CID 19174332) has the molecular formula C16H13ClN2O4S2 and a molecular weight of 396.88 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(3-chlorophenoxy)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 19174332 |
| Molecular Formula | C16H13ClN2O4S2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)COc3cccc(Cl)c3)sc2c1 |
| InChI | InChI=1S/C16H13ClN2O4S2/c1-25(21,22)12-5-6-13-14(8-12)24-16(18-13)19-15(20)9-23-11-4-2-3-10(17)7-11/h2-8H,9H2,1H3,(H,18,19,20) |
| InChIKey | VHOWSEBZMNNKSZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |