C18H18N2O4S2 — CID 55765139
N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-propoxybenzamide (PubChem CID 55765139) has the molecular formula C18H18N2O4S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-propoxybenzamide.
| Compound Name | N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-propoxybenzamide |
|---|---|
| PubChem CID | 55765139 |
| Molecular Formula | C18H18N2O4S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-propoxybenzamide |
| SMILES | CCCOc1cccc(C(=O)Nc2nc3ccc(S(C)(=O)=O)cc3s2)c1 |
| InChI | InChI=1S/C18H18N2O4S2/c1-3-9-24-13-6-4-5-12(10-13)17(21)20-18-19-15-8-7-14(26(2,22)23)11-16(15)25-18/h4-8,10-11H,3,9H2,1-2H3,(H,19,20,21) |
| InChIKey | IDMKZMXJGOBKQT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |