C17H15ClN2O4S2 — CID 2932306
2-(3-chlorophenoxy)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propanamide (PubChem CID 2932306) has the molecular formula C17H15ClN2O4S2 and a molecular weight of 410.90 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 2-(3-chlorophenoxy)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 2932306 |
| Molecular Formula | C17H15ClN2O4S2 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propanamide |
| SMILES | CC(Oc1cccc(Cl)c1)C(=O)Nc1nc2ccc(S(C)(=O)=O)cc2s1 |
| InChI | InChI=1S/C17H15ClN2O4S2/c1-10(24-12-5-3-4-11(18)8-12)16(21)20-17-19-14-7-6-13(26(2,22)23)9-15(14)25-17/h3-10H,1-2H3,(H,19,20,21) |
| InChIKey | HDXULONANHJJCC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |