C17H15ClN2O3S — CID 18837926
N-(6-chloro-1,3-benzothiazol-2-yl)-2-(4-methoxyphenoxy)propanamide (PubChem CID 18837926) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-2-(4-methoxyphenoxy)propanamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2-(4-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 18837926 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2-(4-methoxyphenoxy)propanamide |
| SMILES | COc1ccc(OC(C)C(=O)Nc2nc3ccc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C17H15ClN2O3S/c1-10(23-13-6-4-12(22-2)5-7-13)16(21)20-17-19-14-8-3-11(18)9-15(14)24-17/h3-10H,1-2H3,(H,19,20,21) |
| InChIKey | GLOPCSDVTXVSEM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |