C14H16ClN3O2S — CID 18774937
2-acetamido-N-(6-chloro-1,3-benzothiazol-2-yl)-3-methylbutanamide (PubChem CID 18774937) has the molecular formula C14H16ClN3O2S and a molecular weight of 325.82 g/mol. Its IUPAC name is 2-acetamido-N-(6-chloro-1,3-benzothiazol-2-yl)-3-methylbutanamide.
| Compound Name | 2-acetamido-N-(6-chloro-1,3-benzothiazol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 18774937 |
| Molecular Formula | C14H16ClN3O2S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-acetamido-N-(6-chloro-1,3-benzothiazol-2-yl)-3-methylbutanamide |
| SMILES | CC(=O)NC(C(=O)Nc1nc2ccc(Cl)cc2s1)C(C)C |
| InChI | InChI=1S/C14H16ClN3O2S/c1-7(2)12(16-8(3)19)13(20)18-14-17-10-5-4-9(15)6-11(10)21-14/h4-7,12H,1-3H3,(H,16,19)(H,17,18,20) |
| InChIKey | NAGZVKHNOMIUJY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |