C13H16N4O2S — CID 8928085
(2S)-N-(1,3-benzothiazol-2-yl)-2-(carbamoylamino)-3-methylbutanamide (PubChem CID 8928085) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is (2S)-N-(1,3-benzothiazol-2-yl)-2-(carbamoylamino)-3-methylbutanamide.
| Compound Name | (2S)-N-(1,3-benzothiazol-2-yl)-2-(carbamoylamino)-3-methylbutanamide |
|---|---|
| PubChem CID | 8928085 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (2S)-N-(1,3-benzothiazol-2-yl)-2-(carbamoylamino)-3-methylbutanamide |
| SMILES | CC(C)[C@H](NC(N)=O)C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H16N4O2S/c1-7(2)10(16-12(14)19)11(18)17-13-15-8-5-3-4-6-9(8)20-13/h3-7,10H,1-2H3,(H3,14,16,19)(H,15,17,18)/t10-/m0/s1 |
| InChIKey | PDJFYFXHMPZFKG-JTQLQIEISA-N |
| XLogP | 1.93 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |