C11H13N3O2S — CID 81081342
2-amino-N-(1,3-benzothiazol-2-yl)-3-methoxypropanamide (PubChem CID 81081342) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-amino-N-(1,3-benzothiazol-2-yl)-3-methoxypropanamide.
| Compound Name | 2-amino-N-(1,3-benzothiazol-2-yl)-3-methoxypropanamide |
|---|---|
| PubChem CID | 81081342 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-amino-N-(1,3-benzothiazol-2-yl)-3-methoxypropanamide |
| SMILES | COCC(N)C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H13N3O2S/c1-16-6-7(12)10(15)14-11-13-8-4-2-3-5-9(8)17-11/h2-5,7H,6,12H2,1H3,(H,13,14,15) |
| InChIKey | QPSJFDIQFLTKJI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |