C12H15N3OS2 — CID 104906860
(2R)-2-amino-N-(1,3-benzothiazol-2-yl)-4-methylsulfanylbutanamide (PubChem CID 104906860) has the molecular formula C12H15N3OS2 and a molecular weight of 281.41 g/mol. Its IUPAC name is (2R)-2-amino-N-(1,3-benzothiazol-2-yl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-(1,3-benzothiazol-2-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104906860 |
| Molecular Formula | C12H15N3OS2 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (2R)-2-amino-N-(1,3-benzothiazol-2-yl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](N)C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H15N3OS2/c1-17-7-6-8(13)11(16)15-12-14-9-4-2-3-5-10(9)18-12/h2-5,8H,6-7,13H2,1H3,(H,14,15,16)/t8-/m1/s1 |
| InChIKey | YZHWQYLAHSJTKO-MRVPVSSYSA-N |
| XLogP | 2.32 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |