C11H12AgN2O2S — CID 87950103
N-(1,3-benzothiazol-2-yl)-2-hydroxybutanamide;silver (PubChem CID 87950103) has the molecular formula C11H12AgN2O2S and a molecular weight of 344.16 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-hydroxybutanamide;silver.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-hydroxybutanamide;silver |
|---|---|
| PubChem CID | 87950103 |
| Molecular Formula | C11H12AgN2O2S |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-hydroxybutanamide;silver |
| SMILES | CCC(O)C(=O)Nc1nc2ccccc2s1.[Ag] |
| InChI | InChI=1S/C11H12N2O2S.Ag/c1-2-8(14)10(15)13-11-12-7-5-3-4-6-9(7)16-11;/h3-6,8,14H,2H2,1H3,(H,12,13,15); |
| InChIKey | VSZOZXFMVAUVNH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |