C17H14N2O3S — CID 2933835
[2-(1,3-benzothiazol-2-ylamino)-2-oxo-1-phenylethyl] acetate (PubChem CID 2933835) has the molecular formula C17H14N2O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-ylamino)-2-oxo-1-phenylethyl] acetate.
| Compound Name | [2-(1,3-benzothiazol-2-ylamino)-2-oxo-1-phenylethyl] acetate |
|---|---|
| PubChem CID | 2933835 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | [2-(1,3-benzothiazol-2-ylamino)-2-oxo-1-phenylethyl] acetate |
| SMILES | CC(=O)OC(C(=O)Nc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C17H14N2O3S/c1-11(20)22-15(12-7-3-2-4-8-12)16(21)19-17-18-13-9-5-6-10-14(13)23-17/h2-10,15H,1H3,(H,18,19,21) |
| InChIKey | WHJUAFWGYNBUMM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |