C20H20N2OS — CID 940434
(2R)-N-(1,3-benzothiazol-2-yl)-2-cyclopentyl-2-phenylacetamide (PubChem CID 940434) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is (2R)-N-(1,3-benzothiazol-2-yl)-2-cyclopentyl-2-phenylacetamide.
| Compound Name | (2R)-N-(1,3-benzothiazol-2-yl)-2-cyclopentyl-2-phenylacetamide |
|---|---|
| PubChem CID | 940434 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (2R)-N-(1,3-benzothiazol-2-yl)-2-cyclopentyl-2-phenylacetamide |
| SMILES | O=C(Nc1nc2ccccc2s1)[C@@H](c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C20H20N2OS/c23-19(22-20-21-16-12-6-7-13-17(16)24-20)18(15-10-4-5-11-15)14-8-2-1-3-9-14/h1-3,6-9,12-13,15,18H,4-5,10-11H2,(H,21,22,23)/t18-/m0/s1 |
| InChIKey | LKGOZYVWSIGYAR-SFHVURJKSA-N |
| XLogP | 5.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |