About [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate
[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate (PubChem CID 2915351) has the molecular formula C21H21N3O4S2
and a molecular weight of 443.55 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate.
Molecular Properties
| Compound Name | [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate |
| PubChem CID | 2915351 |
| Molecular Formula | C21H21N3O4S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(=O)c1ccccc1)C(=O)OCC(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C21H21N3O4S2/c1-29-12-11-16(22-19(26)14-7-3-2-4-8-14)20(27)28-13-18(25)24-21-23-15-9-5-6-10-17(15)30-21/h2-10,16H,11-13H2,1H3,(H,22,26)(H,23,24,25) |
| InChIKey | GDEMURGCUKAEJN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate?
The IUPAC name of [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate (CID 2915351) is [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate.
What is the SMILES notation for [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate?
The canonical SMILES for [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate is CSCCC(NC(=O)c1ccccc1)C(=O)OCC(=O)Nc1nc2ccccc2s1.
What is the InChIKey of [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate?
The InChIKey is GDEMURGCUKAEJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O4S2/c1-29-12-11-16(22-19(26)14-7-3-2-4-8-14)20(27)28-13-18(25)24-21-23-15-9-5-6-10-17(15)30-21/h2-10,16H,11-13H2,1H3,(H,22,26)(H,23,24,25).
What are the key properties of [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate?
[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate has a molecular weight of 443.55 g/mol, XLogP of 3.33, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate is sourced from PubChem (CID 2915351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).