C21H21N3O4S — CID 7191240
[2-(2-cyanoanilino)-2-oxoethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate (PubChem CID 7191240) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7191240 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NC(=O)c1ccccc1)C(=O)OCC(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C21H21N3O4S/c1-29-12-11-18(24-20(26)15-7-3-2-4-8-15)21(27)28-14-19(25)23-17-10-6-5-9-16(17)13-22/h2-10,18H,11-12,14H2,1H3,(H,23,25)(H,24,26)/t18-/m1/s1 |
| InChIKey | QJMUEAWHRUBDHP-GOSISDBHSA-N |
| XLogP | 2.59 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |