C23H26N2O6S — CID 51448629
ethyl 4-[[2-[(2R)-2-benzamido-4-methylsulfanylbutanoyl]oxyacetyl]amino]benzoate (PubChem CID 51448629) has the molecular formula C23H26N2O6S and a molecular weight of 458.54 g/mol. Its IUPAC name is ethyl 4-[[2-[(2R)-2-benzamido-4-methylsulfanylbutanoyl]oxyacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(2R)-2-benzamido-4-methylsulfanylbutanoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 51448629 |
| Molecular Formula | C23H26N2O6S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | ethyl 4-[[2-[(2R)-2-benzamido-4-methylsulfanylbutanoyl]oxyacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COC(=O)[C@@H](CCSC)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N2O6S/c1-3-30-22(28)17-9-11-18(12-10-17)24-20(26)15-31-23(29)19(13-14-32-2)25-21(27)16-7-5-4-6-8-16/h4-12,19H,3,13-15H2,1-2H3,(H,24,26)(H,25,27)/t19-/m1/s1 |
| InChIKey | BPLZIFZTSVRXCF-LJQANCHMSA-N |
| XLogP | 2.90 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |