C20H20BrNO4S — CID 40882862
[2-(4-bromophenyl)-2-oxoethyl] (2S)-2-benzamido-4-methylsulfanylbutanoate (PubChem CID 40882862) has the molecular formula C20H20BrNO4S and a molecular weight of 450.35 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] (2S)-2-benzamido-4-methylsulfanylbutanoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] (2S)-2-benzamido-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 40882862 |
| Molecular Formula | C20H20BrNO4S |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] (2S)-2-benzamido-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)c1ccccc1)C(=O)OCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H20BrNO4S/c1-27-12-11-17(22-19(24)15-5-3-2-4-6-15)20(25)26-13-18(23)14-7-9-16(21)10-8-14/h2-10,17H,11-13H2,1H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | PHQWTARCLQQMIX-KRWDZBQOSA-N |
| XLogP | 3.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |