C20H21NO4S — CID 8764120
(4-acetylphenyl) (2R)-2-benzamido-4-methylsulfanylbutanoate (PubChem CID 8764120) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is (4-acetylphenyl) (2R)-2-benzamido-4-methylsulfanylbutanoate.
| Compound Name | (4-acetylphenyl) (2R)-2-benzamido-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 8764120 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (4-acetylphenyl) (2R)-2-benzamido-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NC(=O)c1ccccc1)C(=O)Oc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C20H21NO4S/c1-14(22)15-8-10-17(11-9-15)25-20(24)18(12-13-26-2)21-19(23)16-6-4-3-5-7-16/h3-11,18H,12-13H2,1-2H3,(H,21,23)/t18-/m1/s1 |
| InChIKey | DCZALMZMYXSATR-GOSISDBHSA-N |
| XLogP | 3.35 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|