C24H29N3O3S — CID 35012736
N-[(2S)-1-[4-(4-acetylphenyl)piperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 35012736) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[(2S)-1-[4-(4-acetylphenyl)piperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-[4-(4-acetylphenyl)piperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 35012736 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[(2S)-1-[4-(4-acetylphenyl)piperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CSCC[C@H](NC(=O)c1ccccc1)C(=O)N1CCN(c2ccc(C(C)=O)cc2)CC1 |
| InChI | InChI=1S/C24H29N3O3S/c1-18(28)19-8-10-21(11-9-19)26-13-15-27(16-14-26)24(30)22(12-17-31-2)25-23(29)20-6-4-3-5-7-20/h3-11,22H,12-17H2,1-2H3,(H,25,29)/t22-/m0/s1 |
| InChIKey | BUAFTKAOJCJGOF-QFIPXVFZSA-N |
| XLogP | 3.09 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |