C15H21NO3S — CID 67365199
propyl (2S)-2-benzamido-4-methylsulfanylbutanoate (PubChem CID 67365199) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is propyl (2S)-2-benzamido-4-methylsulfanylbutanoate.
| Compound Name | propyl (2S)-2-benzamido-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 67365199 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | propyl (2S)-2-benzamido-4-methylsulfanylbutanoate |
| SMILES | CCCOC(=O)[C@H](CCSC)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H21NO3S/c1-3-10-19-15(18)13(9-11-20-2)16-14(17)12-7-5-4-6-8-12/h4-8,13H,3,9-11H2,1-2H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | HNSMUHZRHXHQOI-ZDUSSCGKSA-N |
| XLogP | 2.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |