C22H26N2O4S — CID 7191225
[2-(3,4-dimethylanilino)-2-oxoethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate (PubChem CID 7191225) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is [2-(3,4-dimethylanilino)-2-oxoethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate.
| Compound Name | [2-(3,4-dimethylanilino)-2-oxoethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7191225 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [2-(3,4-dimethylanilino)-2-oxoethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NC(=O)c1ccccc1)C(=O)OCC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C22H26N2O4S/c1-15-9-10-18(13-16(15)2)23-20(25)14-28-22(27)19(11-12-29-3)24-21(26)17-7-5-4-6-8-17/h4-10,13,19H,11-12,14H2,1-3H3,(H,23,25)(H,24,26)/t19-/m1/s1 |
| InChIKey | MYBJVSALTAITTJ-LJQANCHMSA-N |
| XLogP | 3.34 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |