C21H23BrN2O4S — CID 51448622
[2-(4-bromo-3-methylanilino)-2-oxoethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate (PubChem CID 51448622) has the molecular formula C21H23BrN2O4S and a molecular weight of 479.40 g/mol. Its IUPAC name is [2-(4-bromo-3-methylanilino)-2-oxoethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate.
| Compound Name | [2-(4-bromo-3-methylanilino)-2-oxoethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 51448622 |
| Molecular Formula | C21H23BrN2O4S |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | [2-(4-bromo-3-methylanilino)-2-oxoethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NC(=O)c1ccccc1)C(=O)OCC(=O)Nc1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C21H23BrN2O4S/c1-14-12-16(8-9-17(14)22)23-19(25)13-28-21(27)18(10-11-29-2)24-20(26)15-6-4-3-5-7-15/h3-9,12,18H,10-11,13H2,1-2H3,(H,23,25)(H,24,26)/t18-/m1/s1 |
| InChIKey | PEJYQAIHOBYYEN-GOSISDBHSA-N |
| XLogP | 3.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |