C20H21BrN2O4 — CID 55379961
[2-(4-bromo-3-methylanilino)-2-oxoethyl] 3-benzamidobutanoate (PubChem CID 55379961) has the molecular formula C20H21BrN2O4 and a molecular weight of 433.30 g/mol. Its IUPAC name is [2-(4-bromo-3-methylanilino)-2-oxoethyl] 3-benzamidobutanoate.
| Compound Name | [2-(4-bromo-3-methylanilino)-2-oxoethyl] 3-benzamidobutanoate |
|---|---|
| PubChem CID | 55379961 |
| Molecular Formula | C20H21BrN2O4 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | [2-(4-bromo-3-methylanilino)-2-oxoethyl] 3-benzamidobutanoate |
| SMILES | Cc1cc(NC(=O)COC(=O)CC(C)NC(=O)c2ccccc2)ccc1Br |
| InChI | InChI=1S/C20H21BrN2O4/c1-13-10-16(8-9-17(13)21)23-18(24)12-27-19(25)11-14(2)22-20(26)15-6-4-3-5-7-15/h3-10,14H,11-12H2,1-2H3,(H,22,26)(H,23,24) |
| InChIKey | UPNBOSDUUWGLIF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |