C25H24N2O5 — CID 55379808
[2-oxo-2-(4-phenoxyanilino)ethyl] 3-benzamidobutanoate (PubChem CID 55379808) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is [2-oxo-2-(4-phenoxyanilino)ethyl] 3-benzamidobutanoate.
| Compound Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 3-benzamidobutanoate |
|---|---|
| PubChem CID | 55379808 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 3-benzamidobutanoate |
| SMILES | CC(CC(=O)OCC(=O)Nc1ccc(Oc2ccccc2)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H24N2O5/c1-18(26-25(30)19-8-4-2-5-9-19)16-24(29)31-17-23(28)27-20-12-14-22(15-13-20)32-21-10-6-3-7-11-21/h2-15,18H,16-17H2,1H3,(H,26,30)(H,27,28) |
| InChIKey | WKJZSWZINHNCGV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |