C26H24N2O6 — CID 29170764
methyl 4-[[2-[(3R)-3-benzamido-3-phenylpropanoyl]oxyacetyl]amino]benzoate (PubChem CID 29170764) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is methyl 4-[[2-[(3R)-3-benzamido-3-phenylpropanoyl]oxyacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(3R)-3-benzamido-3-phenylpropanoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 29170764 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | methyl 4-[[2-[(3R)-3-benzamido-3-phenylpropanoyl]oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)COC(=O)C[C@@H](NC(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N2O6/c1-33-26(32)20-12-14-21(15-13-20)27-23(29)17-34-24(30)16-22(18-8-4-2-5-9-18)28-25(31)19-10-6-3-7-11-19/h2-15,22H,16-17H2,1H3,(H,27,29)(H,28,31)/t22-/m1/s1 |
| InChIKey | LKADZSZDVMWXOL-JOCHJYFZSA-N |
| XLogP | 3.52 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |