C25H22ClN3O5 — CID 2519734
[2-(4-carbamoylanilino)-2-oxoethyl] (3R)-3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate (PubChem CID 2519734) has the molecular formula C25H22ClN3O5 and a molecular weight of 479.92 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] (3R)-3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] (3R)-3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 2519734 |
| Molecular Formula | C25H22ClN3O5 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] (3R)-3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate |
| SMILES | NC(=O)c1ccc(NC(=O)COC(=O)C[C@@H](NC(=O)c2ccccc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22ClN3O5/c26-20-9-5-4-8-19(20)25(33)29-21(16-6-2-1-3-7-16)14-23(31)34-15-22(30)28-18-12-10-17(11-13-18)24(27)32/h1-13,21H,14-15H2,(H2,27,32)(H,28,30)(H,29,33)/t21-/m1/s1 |
| InChIKey | VXENPBZYXBJJJF-OAQYLSRUSA-N |
| XLogP | 3.48 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |