C24H20ClFN2O4 — CID 2364120
[2-(3-fluoroanilino)-2-oxoethyl] (3R)-3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate (PubChem CID 2364120) has the molecular formula C24H20ClFN2O4 and a molecular weight of 454.89 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] (3R)-3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] (3R)-3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 2364120 |
| Molecular Formula | C24H20ClFN2O4 |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] (3R)-3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate |
| SMILES | O=C(COC(=O)C[C@@H](NC(=O)c1ccccc1Cl)c1ccccc1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C24H20ClFN2O4/c25-20-12-5-4-11-19(20)24(31)28-21(16-7-2-1-3-8-16)14-23(30)32-15-22(29)27-18-10-6-9-17(26)13-18/h1-13,21H,14-15H2,(H,27,29)(H,28,31)/t21-/m1/s1 |
| InChIKey | NMHYNOGXALRHCR-OAQYLSRUSA-N |
| XLogP | 4.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |